About chrysene-1,2,3-tricarbaldehyde
chrysene-1,2,3-tricarbaldehyde (PubChem CID 141144423) has the molecular formula C21H12O3
and a molecular weight of 312.32 g/mol. Its IUPAC name is chrysene-1,2,3-tricarbaldehyde.
Molecular Properties
| Compound Name | chrysene-1,2,3-tricarbaldehyde |
| PubChem CID | 141144423 |
| Molecular Formula | C21H12O3 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | chrysene-1,2,3-tricarbaldehyde |
| SMILES | O=Cc1cc2c(ccc3c4ccccc4ccc23)c(C=O)c1C=O |
| InChI | InChI=1S/C21H12O3/c22-10-14-9-19-17-6-5-13-3-1-2-4-15(13)16(17)7-8-18(19)21(12-24)20(14)11-23/h1-12H |
| InChIKey | RCHSXLBLDDOENE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze chrysene-1,2,3-tricarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chrysene-1,2,3-tricarbaldehyde?
The IUPAC name of chrysene-1,2,3-tricarbaldehyde (CID 141144423) is chrysene-1,2,3-tricarbaldehyde.
What is the SMILES notation for chrysene-1,2,3-tricarbaldehyde?
The canonical SMILES for chrysene-1,2,3-tricarbaldehyde is O=Cc1cc2c(ccc3c4ccccc4ccc23)c(C=O)c1C=O.
What is the InChIKey of chrysene-1,2,3-tricarbaldehyde?
The InChIKey is RCHSXLBLDDOENE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12O3/c22-10-14-9-19-17-6-5-13-3-1-2-4-15(13)16(17)7-8-18(19)21(12-24)20(14)11-23/h1-12H.
What are the key properties of chrysene-1,2,3-tricarbaldehyde?
chrysene-1,2,3-tricarbaldehyde has a molecular weight of 312.32 g/mol, XLogP of 4.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chrysene-1,2,3-tricarbaldehyde is sourced from PubChem (CID 141144423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).