C17H18 — CID 143956206
2,3-bis(ethenyl)-1-propylnaphthalene (PubChem CID 143956206) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1-propylnaphthalene.
| Compound Name | 2,3-bis(ethenyl)-1-propylnaphthalene |
|---|---|
| PubChem CID | 143956206 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2,3-bis(ethenyl)-1-propylnaphthalene |
| SMILES | C=Cc1cc2ccccc2c(CCC)c1C=C |
| InChI | InChI=1S/C17H18/c1-4-9-17-15(6-3)13(5-2)12-14-10-7-8-11-16(14)17/h5-8,10-12H,2-4,9H2,1H3 |
| InChIKey | BRSFXMVKMOIWEU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |