C16H19BO2 — CID 142377515
[2,3-bis(ethenyl)naphthalen-1-yl]boronic acid;ethane (PubChem CID 142377515) has the molecular formula C16H19BO2 and a molecular weight of 254.14 g/mol. Its IUPAC name is [2,3-bis(ethenyl)naphthalen-1-yl]boronic acid;ethane.
| Compound Name | [2,3-bis(ethenyl)naphthalen-1-yl]boronic acid;ethane |
|---|---|
| PubChem CID | 142377515 |
| Molecular Formula | C16H19BO2 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [2,3-bis(ethenyl)naphthalen-1-yl]boronic acid;ethane |
| SMILES | C=Cc1cc2ccccc2c(B(O)O)c1C=C.CC |
| InChI | InChI=1S/C14H13BO2.C2H6/c1-3-10-9-11-7-5-6-8-13(11)14(15(16)17)12(10)4-2;1-2/h3-9,16-17H,1-2H2;1-2H3 |
| InChIKey | FOZWIAKBKFRPCZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|