About anthracen-9-ylboronic acid;9-bromoanthracene
anthracen-9-ylboronic acid;9-bromoanthracene (PubChem CID 157130020) has the molecular formula C28H20BBrO2
and a molecular weight of 479.18 g/mol. Its IUPAC name is anthracen-9-ylboronic acid;9-bromoanthracene.
Molecular Properties
| Compound Name | anthracen-9-ylboronic acid;9-bromoanthracene |
| PubChem CID | 157130020 |
| Molecular Formula | C28H20BBrO2 |
| Molecular Weight | 479.18 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | anthracen-9-ylboronic acid;9-bromoanthracene |
| SMILES | Brc1c2ccccc2cc2ccccc12.OB(O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C14H11BO2.C14H9Br/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,16-17H;1-9H |
| InChIKey | AIYNNGTZTOBPDG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.18 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracen-9-ylboronic acid;9-bromoanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-9-ylboronic acid;9-bromoanthracene?
The IUPAC name of anthracen-9-ylboronic acid;9-bromoanthracene (CID 157130020) is anthracen-9-ylboronic acid;9-bromoanthracene.
What is the SMILES notation for anthracen-9-ylboronic acid;9-bromoanthracene?
The canonical SMILES for anthracen-9-ylboronic acid;9-bromoanthracene is Brc1c2ccccc2cc2ccccc12.OB(O)c1c2ccccc2cc2ccccc12.
What is the InChIKey of anthracen-9-ylboronic acid;9-bromoanthracene?
The InChIKey is AIYNNGTZTOBPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BO2.C14H9Br/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,16-17H;1-9H.
What are the key properties of anthracen-9-ylboronic acid;9-bromoanthracene?
anthracen-9-ylboronic acid;9-bromoanthracene has a molecular weight of 479.18 g/mol, XLogP of 6.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-9-ylboronic acid;9-bromoanthracene is sourced from PubChem (CID 157130020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).