About 9-bromo-2,3-dimethylanthracene
9-bromo-2,3-dimethylanthracene (PubChem CID 77134418) has the molecular formula C16H13Br
and a molecular weight of 285.18 g/mol. Its IUPAC name is 9-bromo-2,3-dimethylanthracene.
Molecular Properties
| Compound Name | 9-bromo-2,3-dimethylanthracene |
| PubChem CID | 77134418 |
| Molecular Formula | C16H13Br |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 9-bromo-2,3-dimethylanthracene |
| SMILES | Cc1cc2cc3ccccc3c(Br)c2cc1C |
| InChI | InChI=1S/C16H13Br/c1-10-7-13-9-12-5-3-4-6-14(12)16(17)15(13)8-11(10)2/h3-9H,1-2H3 |
| InChIKey | XWTCUMKTPIJYEZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-2,3-dimethylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-2,3-dimethylanthracene?
The IUPAC name of 9-bromo-2,3-dimethylanthracene (CID 77134418) is 9-bromo-2,3-dimethylanthracene.
What is the SMILES notation for 9-bromo-2,3-dimethylanthracene?
The canonical SMILES for 9-bromo-2,3-dimethylanthracene is Cc1cc2cc3ccccc3c(Br)c2cc1C.
What is the InChIKey of 9-bromo-2,3-dimethylanthracene?
The InChIKey is XWTCUMKTPIJYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Br/c1-10-7-13-9-12-5-3-4-6-14(12)16(17)15(13)8-11(10)2/h3-9H,1-2H3.
What are the key properties of 9-bromo-2,3-dimethylanthracene?
9-bromo-2,3-dimethylanthracene has a molecular weight of 285.18 g/mol, XLogP of 5.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-2,3-dimethylanthracene is sourced from PubChem (CID 77134418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).