C24H20 — CID 123541767
1-[2,3,5,6-tetrakis(ethenyl)phenyl]naphthalene (PubChem CID 123541767) has the molecular formula C24H20 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-[2,3,5,6-tetrakis(ethenyl)phenyl]naphthalene.
| Compound Name | 1-[2,3,5,6-tetrakis(ethenyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 123541767 |
| Molecular Formula | C24H20 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-[2,3,5,6-tetrakis(ethenyl)phenyl]naphthalene |
| SMILES | C=Cc1cc(C=C)c(C=C)c(-c2cccc3ccccc23)c1C=C |
| InChI | InChI=1S/C24H20/c1-5-17-16-18(6-2)21(8-4)24(20(17)7-3)23-15-11-13-19-12-9-10-14-22(19)23/h5-16H,1-4H2 |
| InChIKey | DDMWFJPFYZHZST-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |