C15H14O3S — CID 150256268
methyl 2,3-bis(ethenyl)naphthalene-1-sulfonate (PubChem CID 150256268) has the molecular formula C15H14O3S and a molecular weight of 274.34 g/mol. Its IUPAC name is methyl 2,3-bis(ethenyl)naphthalene-1-sulfonate.
| Compound Name | methyl 2,3-bis(ethenyl)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 150256268 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | methyl 2,3-bis(ethenyl)naphthalene-1-sulfonate |
| SMILES | C=Cc1cc2ccccc2c(S(=O)(=O)OC)c1C=C |
| InChI | InChI=1S/C15H14O3S/c1-4-11-10-12-8-6-7-9-14(12)15(13(11)5-2)19(16,17)18-3/h4-10H,1-2H2,3H3 |
| InChIKey | GAPVUJYDTAKJRZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|