C32H26 — CID 140635940
2,3-bis(ethenyl)-1-[3-[(1E,3Z)-hexa-1,3,5-trienyl]-5-phenylphenyl]naphthalene (PubChem CID 140635940) has the molecular formula C32H26 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1-[3-[(1E,3Z)-hexa-1,3,5-trienyl]-5-phenylphenyl]naphthalene.
| Compound Name | 2,3-bis(ethenyl)-1-[3-[(1E,3Z)-hexa-1,3,5-trienyl]-5-phenylphenyl]naphthalene |
|---|---|
| PubChem CID | 140635940 |
| Molecular Formula | C32H26 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2,3-bis(ethenyl)-1-[3-[(1E,3Z)-hexa-1,3,5-trienyl]-5-phenylphenyl]naphthalene |
| SMILES | C=C/C=C\C=C\c1cc(-c2ccccc2)cc(-c2c(C=C)c(C=C)cc3ccccc23)c1 |
| InChI | InChI=1S/C32H26/c1-4-7-8-10-15-24-20-28(26-16-11-9-12-17-26)23-29(21-24)32-30(6-3)25(5-2)22-27-18-13-14-19-31(27)32/h4-23H,1-3H2/b8-7-,15-10+ |
| InChIKey | GFEAEFYHOSKCTR-XFOMCHIZSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|