About formaldehyde;methyl naphthalene-1-sulfonate
formaldehyde;methyl naphthalene-1-sulfonate (PubChem CID 87369958) has the molecular formula C12H12O4S
and a molecular weight of 252.29 g/mol. Its IUPAC name is formaldehyde;methyl naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | formaldehyde;methyl naphthalene-1-sulfonate |
| PubChem CID | 87369958 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | formaldehyde;methyl naphthalene-1-sulfonate |
| SMILES | C=O.COS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C11H10O3S.CH2O/c1-14-15(12,13)11-8-4-6-9-5-2-3-7-10(9)11;1-2/h2-8H,1H3;1H2 |
| InChIKey | XUZHLZDRCCUWEV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;methyl naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;methyl naphthalene-1-sulfonate?
The IUPAC name of formaldehyde;methyl naphthalene-1-sulfonate (CID 87369958) is formaldehyde;methyl naphthalene-1-sulfonate.
What is the SMILES notation for formaldehyde;methyl naphthalene-1-sulfonate?
The canonical SMILES for formaldehyde;methyl naphthalene-1-sulfonate is C=O.COS(=O)(=O)c1cccc2ccccc12.
What is the InChIKey of formaldehyde;methyl naphthalene-1-sulfonate?
The InChIKey is XUZHLZDRCCUWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3S.CH2O/c1-14-15(12,13)11-8-4-6-9-5-2-3-7-10(9)11;1-2/h2-8H,1H3;1H2.
What are the key properties of formaldehyde;methyl naphthalene-1-sulfonate?
formaldehyde;methyl naphthalene-1-sulfonate has a molecular weight of 252.29 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;methyl naphthalene-1-sulfonate is sourced from PubChem (CID 87369958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).