About naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate
naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate (PubChem CID 174434530) has the molecular formula C20H14O7S3
and a molecular weight of 462.53 g/mol. Its IUPAC name is naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate |
| PubChem CID | 174434530 |
| Molecular Formula | C20H14O7S3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate |
| SMILES | O=S(OS(=O)(=O)c1cccc2ccccc12)OS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H14O7S3/c21-28(26-29(22,23)19-13-5-9-15-7-1-3-11-17(15)19)27-30(24,25)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
| InChIKey | ZUYHDHSHFKSWOC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate?
The IUPAC name of naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate (CID 174434530) is naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate.
What is the SMILES notation for naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate?
The canonical SMILES for naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate is O=S(OS(=O)(=O)c1cccc2ccccc12)OS(=O)(=O)c1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate?
The InChIKey is ZUYHDHSHFKSWOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O7S3/c21-28(26-29(22,23)19-13-5-9-15-7-1-3-11-17(15)19)27-30(24,25)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H.
What are the key properties of naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate?
naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate has a molecular weight of 462.53 g/mol, XLogP of 3.68, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylsulfonyloxysulfinyl naphthalene-1-sulfonate is sourced from PubChem (CID 174434530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).