About CID 175921025
CID 175921025 (PubChem CID 175921025) has the molecular formula C17H14O3SSn
and a molecular weight of 417.07 g/mol.
Molecular Properties
| Compound Name | CID 175921025 |
| PubChem CID | 175921025 |
| Molecular Formula | C17H14O3SSn |
| Molecular Weight | 417.07 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | — |
| SMILES | O=S(=O)(OCc1ccccc1)c1cccc2ccccc12.[Sn] |
| InChI | InChI=1S/C17H14O3S.Sn/c18-21(19,20-13-14-7-2-1-3-8-14)17-12-6-10-15-9-4-5-11-16(15)17;/h1-12H,13H2; |
| InChIKey | BNDJGOJABMPHPB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.07 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze CID 175921025 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175921025?
The IUPAC name of CID 175921025 (CID 175921025) is not available.
What is the SMILES notation for CID 175921025?
The canonical SMILES for CID 175921025 is O=S(=O)(OCc1ccccc1)c1cccc2ccccc12.[Sn].
What is the InChIKey of CID 175921025?
The InChIKey is BNDJGOJABMPHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O3S.Sn/c18-21(19,20-13-14-7-2-1-3-8-14)17-12-6-10-15-9-4-5-11-16(15)17;/h1-12H,13H2;.
What are the key properties of CID 175921025?
CID 175921025 has a molecular weight of 417.07 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175921025 is sourced from PubChem (CID 175921025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).