About tert-butyl naphthalene-1-sulfonate
tert-butyl naphthalene-1-sulfonate (PubChem CID 22062611) has the molecular formula C14H16O3S
and a molecular weight of 264.35 g/mol. Its IUPAC name is tert-butyl naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | tert-butyl naphthalene-1-sulfonate |
| PubChem CID | 22062611 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | tert-butyl naphthalene-1-sulfonate |
| SMILES | CC(C)(C)OS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H16O3S/c1-14(2,3)17-18(15,16)13-10-6-8-11-7-4-5-9-12(11)13/h4-10H,1-3H3 |
| InChIKey | RSEHMVDVWGHIAQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl naphthalene-1-sulfonate?
The IUPAC name of tert-butyl naphthalene-1-sulfonate (CID 22062611) is tert-butyl naphthalene-1-sulfonate.
What is the SMILES notation for tert-butyl naphthalene-1-sulfonate?
The canonical SMILES for tert-butyl naphthalene-1-sulfonate is CC(C)(C)OS(=O)(=O)c1cccc2ccccc12.
What is the InChIKey of tert-butyl naphthalene-1-sulfonate?
The InChIKey is RSEHMVDVWGHIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3S/c1-14(2,3)17-18(15,16)13-10-6-8-11-7-4-5-9-12(11)13/h4-10H,1-3H3.
What are the key properties of tert-butyl naphthalene-1-sulfonate?
tert-butyl naphthalene-1-sulfonate has a molecular weight of 264.35 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl naphthalene-1-sulfonate is sourced from PubChem (CID 22062611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).