About sodium;tert-butyl naphthalene-1-sulfonate;hydride
sodium;tert-butyl naphthalene-1-sulfonate;hydride (PubChem CID 173385942) has the molecular formula C14H17NaO3S
and a molecular weight of 288.34 g/mol. Its IUPAC name is sodium;tert-butyl naphthalene-1-sulfonate;hydride.
Molecular Properties
| Compound Name | sodium;tert-butyl naphthalene-1-sulfonate;hydride |
| PubChem CID | 173385942 |
| Molecular Formula | C14H17NaO3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | sodium;tert-butyl naphthalene-1-sulfonate;hydride |
| SMILES | CC(C)(C)OS(=O)(=O)c1cccc2ccccc12.[H-].[Na+] |
| InChI | InChI=1S/C14H16O3S.Na.H/c1-14(2,3)17-18(15,16)13-10-6-8-11-7-4-5-9-12(11)13;;/h4-10H,1-3H3;;/q;+1;-1 |
| InChIKey | SQMLSXCPHCHPRG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;tert-butyl naphthalene-1-sulfonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;tert-butyl naphthalene-1-sulfonate;hydride?
The IUPAC name of sodium;tert-butyl naphthalene-1-sulfonate;hydride (CID 173385942) is sodium;tert-butyl naphthalene-1-sulfonate;hydride.
What is the SMILES notation for sodium;tert-butyl naphthalene-1-sulfonate;hydride?
The canonical SMILES for sodium;tert-butyl naphthalene-1-sulfonate;hydride is CC(C)(C)OS(=O)(=O)c1cccc2ccccc12.[H-].[Na+].
What is the InChIKey of sodium;tert-butyl naphthalene-1-sulfonate;hydride?
The InChIKey is SQMLSXCPHCHPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3S.Na.H/c1-14(2,3)17-18(15,16)13-10-6-8-11-7-4-5-9-12(11)13;;/h4-10H,1-3H3;;/q;+1;-1.
What are the key properties of sodium;tert-butyl naphthalene-1-sulfonate;hydride?
sodium;tert-butyl naphthalene-1-sulfonate;hydride has a molecular weight of 288.34 g/mol, XLogP of 0.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;tert-butyl naphthalene-1-sulfonate;hydride is sourced from PubChem (CID 173385942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).