About naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate
naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate (PubChem CID 175041270) has the molecular formula C31H24O6S2
and a molecular weight of 556.66 g/mol. Its IUPAC name is naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate |
| PubChem CID | 175041270 |
| Molecular Formula | C31H24O6S2 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate |
| SMILES | O=S(=O)(OCOS(=O)(=O)c1cccc2ccccc12)c1cccc2ccccc12.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H16O6S2.C10H8/c22-28(23,20-13-5-9-16-7-1-3-11-18(16)20)26-15-27-29(24,25)21-14-6-10-17-8-2-4-12-19(17)21;1-2-6-10-8-4-3-7-9(10)5-1/h1-14H,15H2;1-8H |
| InChIKey | XNBHZGHWWHWCKI-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate?
The IUPAC name of naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate (CID 175041270) is naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate.
What is the SMILES notation for naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate?
The canonical SMILES for naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate is O=S(=O)(OCOS(=O)(=O)c1cccc2ccccc12)c1cccc2ccccc12.c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate?
The InChIKey is XNBHZGHWWHWCKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16O6S2.C10H8/c22-28(23,20-13-5-9-16-7-1-3-11-18(16)20)26-15-27-29(24,25)21-14-6-10-17-8-2-4-12-19(17)21;1-2-6-10-8-4-3-7-9(10)5-1/h1-14H,15H2;1-8H.
What are the key properties of naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate?
naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate has a molecular weight of 556.66 g/mol, XLogP of 6.90, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate is sourced from PubChem (CID 175041270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).