About [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate
[4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate (PubChem CID 88693060) has the molecular formula C25H22O3S
and a molecular weight of 402.52 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate |
| PubChem CID | 88693060 |
| Molecular Formula | C25H22O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate |
| SMILES | CC(C)(c1ccccc1)c1ccc(OS(=O)(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H22O3S/c1-25(2,20-11-4-3-5-12-20)21-15-17-22(18-16-21)28-29(26,27)24-14-8-10-19-9-6-7-13-23(19)24/h3-18H,1-2H3 |
| InChIKey | QQGAUOVDUBOPBQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate?
The IUPAC name of [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate (CID 88693060) is [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate.
What is the SMILES notation for [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate?
The canonical SMILES for [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate is CC(C)(c1ccccc1)c1ccc(OS(=O)(=O)c2cccc3ccccc23)cc1.
What is the InChIKey of [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate?
The InChIKey is QQGAUOVDUBOPBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O3S/c1-25(2,20-11-4-3-5-12-20)21-15-17-22(18-16-21)28-29(26,27)24-14-8-10-19-9-6-7-13-23(19)24/h3-18H,1-2H3.
What are the key properties of [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate?
[4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate has a molecular weight of 402.52 g/mol, XLogP of 5.93, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-phenylpropan-2-yl)phenyl] naphthalene-1-sulfonate is sourced from PubChem (CID 88693060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).