C19H17NO5S — CID 51049475
2-amino-3-(4-naphthalen-1-ylsulfonyloxyphenyl)propanoic acid (PubChem CID 51049475) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-amino-3-(4-naphthalen-1-ylsulfonyloxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(4-naphthalen-1-ylsulfonyloxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 51049475 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-amino-3-(4-naphthalen-1-ylsulfonyloxyphenyl)propanoic acid |
| SMILES | NC(Cc1ccc(OS(=O)(=O)c2cccc3ccccc23)cc1)C(=O)O |
| InChI | InChI=1S/C19H17NO5S/c20-17(19(21)22)12-13-8-10-15(11-9-13)25-26(23,24)18-7-3-5-14-4-1-2-6-16(14)18/h1-11,17H,12,20H2,(H,21,22) |
| InChIKey | XLORGUWSSAQWLO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|