C13H22N2O6S — CID 174666785
2-amino-3-(4-sulfooxyphenyl)propanoic acid;butan-1-amine (PubChem CID 174666785) has the molecular formula C13H22N2O6S and a molecular weight of 334.39 g/mol. Its IUPAC name is 2-amino-3-(4-sulfooxyphenyl)propanoic acid;butan-1-amine.
| Compound Name | 2-amino-3-(4-sulfooxyphenyl)propanoic acid;butan-1-amine |
|---|---|
| PubChem CID | 174666785 |
| Molecular Formula | C13H22N2O6S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-amino-3-(4-sulfooxyphenyl)propanoic acid;butan-1-amine |
| SMILES | CCCCN.NC(Cc1ccc(OS(=O)(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO6S.C4H11N/c10-8(9(11)12)5-6-1-3-7(4-2-6)16-17(13,14)15;1-2-3-4-5/h1-4,8H,5,10H2,(H,11,12)(H,13,14,15);2-5H2,1H3 |
| InChIKey | MBPXFVJZAXKDNR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|