C15H13I2NO7S — CID 131769814
(2R)-2-amino-3-[4-(3,5-diiodo-4-sulfooxyphenoxy)phenyl]propanoic acid (PubChem CID 131769814) has the molecular formula C15H13I2NO7S and a molecular weight of 605.14 g/mol. Its IUPAC name is (2R)-2-amino-3-[4-(3,5-diiodo-4-sulfooxyphenoxy)phenyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[4-(3,5-diiodo-4-sulfooxyphenoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 131769814 |
| Molecular Formula | C15H13I2NO7S |
| Molecular Weight | 605.14 g/mol |
| Exact Mass | 604.85 |
| IUPAC Name | (2R)-2-amino-3-[4-(3,5-diiodo-4-sulfooxyphenoxy)phenyl]propanoic acid |
| SMILES | N[C@H](Cc1ccc(Oc2cc(I)c(OS(=O)(=O)O)c(I)c2)cc1)C(=O)O |
| InChI | InChI=1S/C15H13I2NO7S/c16-11-6-10(7-12(17)14(11)25-26(21,22)23)24-9-3-1-8(2-4-9)5-13(18)15(19)20/h1-4,6-7,13H,5,18H2,(H,19,20)(H,21,22,23)/t13-/m1/s1 |
| InChIKey | BVGCAAVTXFZYKS-CYBMUJFWSA-N |
| XLogP | 2.82 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.14 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|