C15H13I2NO4 — CID 67894139
(2R)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)phenyl]propanoic acid (PubChem CID 67894139) has the molecular formula C15H13I2NO4 and a molecular weight of 525.08 g/mol. Its IUPAC name is (2R)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)phenyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67894139 |
| Molecular Formula | C15H13I2NO4 |
| Molecular Weight | 525.08 g/mol |
| Exact Mass | 524.89 |
| IUPAC Name | (2R)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)phenyl]propanoic acid |
| SMILES | N[C@H](Cc1ccc(Oc2cc(I)c(O)c(I)c2)cc1)C(=O)O |
| InChI | InChI=1S/C15H13I2NO4/c16-11-6-10(7-12(17)14(11)19)22-9-3-1-8(2-4-9)5-13(18)15(20)21/h1-4,6-7,13,19H,5,18H2,(H,20,21)/t13-/m1/s1 |
| InChIKey | LROTZSUGDZPWDN-CYBMUJFWSA-N |
| XLogP | 3.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.08 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|