C17H20I2NO4+ — CID 158109254
[3-[4-(4-hydroxy-3,5-diiodophenoxy)phenyl]-1-methoxy-1-oxopropan-2-yl]azanium;methane (PubChem CID 158109254) has the molecular formula C17H20I2NO4+ and a molecular weight of 556.16 g/mol. Its IUPAC name is [3-[4-(4-hydroxy-3,5-diiodophenoxy)phenyl]-1-methoxy-1-oxopropan-2-yl]azanium;methane.
| Compound Name | [3-[4-(4-hydroxy-3,5-diiodophenoxy)phenyl]-1-methoxy-1-oxopropan-2-yl]azanium;methane |
|---|---|
| PubChem CID | 158109254 |
| Molecular Formula | C17H20I2NO4+ |
| Molecular Weight | 556.16 g/mol |
| Exact Mass | 555.95 |
| IUPAC Name | [3-[4-(4-hydroxy-3,5-diiodophenoxy)phenyl]-1-methoxy-1-oxopropan-2-yl]azanium;methane |
| SMILES | C.COC(=O)C([NH3+])Cc1ccc(Oc2cc(I)c(O)c(I)c2)cc1 |
| InChI | InChI=1S/C16H15I2NO4.CH4/c1-22-16(21)14(19)6-9-2-4-10(5-3-9)23-11-7-12(17)15(20)13(18)8-11;/h2-5,7-8,14,20H,6,19H2,1H3;1H4/p+1 |
| InChIKey | FQFKHPCICCELHA-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|