C10H12I2NO3+ — CID 76764107
[(2R)-3-(4-hydroxy-3,5-diiodophenyl)-1-methoxy-1-oxopropan-2-yl]azanium (PubChem CID 76764107) has the molecular formula C10H12I2NO3+ and a molecular weight of 448.02 g/mol. Its IUPAC name is [(2R)-3-(4-hydroxy-3,5-diiodophenyl)-1-methoxy-1-oxopropan-2-yl]azanium.
| Compound Name | [(2R)-3-(4-hydroxy-3,5-diiodophenyl)-1-methoxy-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 76764107 |
| Molecular Formula | C10H12I2NO3+ |
| Molecular Weight | 448.02 g/mol |
| Exact Mass | 447.89 |
| IUPAC Name | [(2R)-3-(4-hydroxy-3,5-diiodophenyl)-1-methoxy-1-oxopropan-2-yl]azanium |
| SMILES | COC(=O)[C@H]([NH3+])Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C10H11I2NO3/c1-16-10(15)8(13)4-5-2-6(11)9(14)7(12)3-5/h2-3,8,14H,4,13H2,1H3/p+1/t8-/m1/s1 |
| InChIKey | TWUDQOSVGDGRHW-MRVPVSSYSA-O |
| XLogP | 0.93 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.02 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|