C10H13NO6S — CID 138319373
[4-[(2S)-2-azaniumyl-3-methoxy-3-oxopropyl]phenyl] sulfate (PubChem CID 138319373) has the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. Its IUPAC name is [4-[(2S)-2-azaniumyl-3-methoxy-3-oxopropyl]phenyl] sulfate.
| Compound Name | [4-[(2S)-2-azaniumyl-3-methoxy-3-oxopropyl]phenyl] sulfate |
|---|---|
| PubChem CID | 138319373 |
| Molecular Formula | C10H13NO6S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | [4-[(2S)-2-azaniumyl-3-methoxy-3-oxopropyl]phenyl] sulfate |
| SMILES | COC(=O)[C@@H]([NH3+])Cc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C10H13NO6S/c1-16-10(12)9(11)6-7-2-4-8(5-3-7)17-18(13,14)15/h2-5,9H,6,11H2,1H3,(H,13,14,15)/t9-/m0/s1 |
| InChIKey | VBDFIILFQPTRLI-VIFPVBQESA-N |
| XLogP | -1.15 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|