About [4-(2-aminoethyl)phenyl] sulfate
[4-(2-aminoethyl)phenyl] sulfate (PubChem CID 50936769) has the molecular formula C8H10NO4S-
and a molecular weight of 216.24 g/mol. Its IUPAC name is [4-(2-aminoethyl)phenyl] sulfate.
Molecular Properties
| Compound Name | [4-(2-aminoethyl)phenyl] sulfate |
| PubChem CID | 50936769 |
| Molecular Formula | C8H10NO4S- |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | [4-(2-aminoethyl)phenyl] sulfate |
| SMILES | NCCc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H11NO4S/c9-6-5-7-1-3-8(4-2-7)13-14(10,11)12/h1-4H,5-6,9H2,(H,10,11,12)/p-1 |
| InChIKey | DYDUXGMDSXJQFT-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-aminoethyl)phenyl] sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-aminoethyl)phenyl] sulfate?
The IUPAC name of [4-(2-aminoethyl)phenyl] sulfate (CID 50936769) is [4-(2-aminoethyl)phenyl] sulfate.
What is the SMILES notation for [4-(2-aminoethyl)phenyl] sulfate?
The canonical SMILES for [4-(2-aminoethyl)phenyl] sulfate is NCCc1ccc(OS(=O)(=O)[O-])cc1.
What is the InChIKey of [4-(2-aminoethyl)phenyl] sulfate?
The InChIKey is DYDUXGMDSXJQFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H11NO4S/c9-6-5-7-1-3-8(4-2-7)13-14(10,11)12/h1-4H,5-6,9H2,(H,10,11,12)/p-1.
What are the key properties of [4-(2-aminoethyl)phenyl] sulfate?
[4-(2-aminoethyl)phenyl] sulfate has a molecular weight of 216.24 g/mol, XLogP of 0.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-aminoethyl)phenyl] sulfate is sourced from PubChem (CID 50936769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).