About 4-(2-aminopropyl)phenol;hydrobromide
4-(2-aminopropyl)phenol;hydrobromide (PubChem CID 9377) has the molecular formula C9H14BrNO
and a molecular weight of 232.12 g/mol. Its IUPAC name is 4-(2-aminopropyl)phenol;hydrobromide.
Molecular Properties
| Compound Name | 4-(2-aminopropyl)phenol;hydrobromide |
| PubChem CID | 9377 |
| Molecular Formula | C9H14BrNO |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4-(2-aminopropyl)phenol;hydrobromide |
| SMILES | Br.CC(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO.BrH/c1-7(10)6-8-2-4-9(11)5-3-8;/h2-5,7,11H,6,10H2,1H3;1H |
| InChIKey | RZCJLMTXBMNRAD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.12 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-aminopropyl)phenol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminopropyl)phenol;hydrobromide?
The IUPAC name of 4-(2-aminopropyl)phenol;hydrobromide (CID 9377) is 4-(2-aminopropyl)phenol;hydrobromide.
What is the SMILES notation for 4-(2-aminopropyl)phenol;hydrobromide?
The canonical SMILES for 4-(2-aminopropyl)phenol;hydrobromide is Br.CC(N)Cc1ccc(O)cc1.
What is the InChIKey of 4-(2-aminopropyl)phenol;hydrobromide?
The InChIKey is RZCJLMTXBMNRAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.BrH/c1-7(10)6-8-2-4-9(11)5-3-8;/h2-5,7,11H,6,10H2,1H3;1H.
What are the key properties of 4-(2-aminopropyl)phenol;hydrobromide?
4-(2-aminopropyl)phenol;hydrobromide has a molecular weight of 232.12 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminopropyl)phenol;hydrobromide is sourced from PubChem (CID 9377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).