About Hydroxyamphetamine Hydrobromide
Hydroxyamphetamine Hydrobromide (PubChem CID 9377) has the molecular formula C9H14BrNO
and a molecular weight of 232.12 g/mol. Its IUPAC name is 4-(2-aminopropyl)phenol;hydrobromide.
Molecular Properties
| Compound Name | Hydroxyamphetamine Hydrobromide |
| PubChem CID | 9377 |
| Molecular Formula | C9H14BrNO |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4-(2-aminopropyl)phenol;hydrobromide |
| SMILES | CC(CC1=CC=C(C=C1)O)N.Br |
| InChI | InChI=1S/C9H13NO.BrH/c1-7(10)6-8-2-4-9(11)5-3-8;/h2-5,7,11H,6,10H2,1H3;1H |
| InChIKey | RZCJLMTXBMNRAD-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 46.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 108 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Hydroxyamphetamine Hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hydroxyamphetamine Hydrobromide?
The IUPAC name of Hydroxyamphetamine Hydrobromide (CID 9377) is 4-(2-aminopropyl)phenol;hydrobromide.
What is the SMILES notation for Hydroxyamphetamine Hydrobromide?
The canonical SMILES for Hydroxyamphetamine Hydrobromide is CC(CC1=CC=C(C=C1)O)N.Br.
What is the InChIKey of Hydroxyamphetamine Hydrobromide?
The InChIKey is RZCJLMTXBMNRAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.BrH/c1-7(10)6-8-2-4-9(11)5-3-8;/h2-5,7,11H,6,10H2,1H3;1H.
What are the key properties of Hydroxyamphetamine Hydrobromide?
Hydroxyamphetamine Hydrobromide has a molecular weight of 232.12 g/mol, XLogP of not available, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Hydroxyamphetamine Hydrobromide is sourced from PubChem (CID 9377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).