C11H14F2NO3+ — CID 2341976
[(2S)-3-[4-(difluoromethoxy)phenyl]-1-methoxy-1-oxopropan-2-yl]azanium (PubChem CID 2341976) has the molecular formula C11H14F2NO3+ and a molecular weight of 246.23 g/mol. Its IUPAC name is [(2S)-3-[4-(difluoromethoxy)phenyl]-1-methoxy-1-oxopropan-2-yl]azanium.
| Compound Name | [(2S)-3-[4-(difluoromethoxy)phenyl]-1-methoxy-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 2341976 |
| Molecular Formula | C11H14F2NO3+ |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | [(2S)-3-[4-(difluoromethoxy)phenyl]-1-methoxy-1-oxopropan-2-yl]azanium |
| SMILES | COC(=O)[C@@H]([NH3+])Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C11H13F2NO3/c1-16-10(15)9(14)6-7-2-4-8(5-3-7)17-11(12)13/h2-5,9,11H,6,14H2,1H3/p+1/t9-/m0/s1 |
| InChIKey | KBBVNSUCEDGBFZ-VIFPVBQESA-O |
| XLogP | 0.61 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |