C12H10F2O5 — CID 17024669
methyl 4-[4-(difluoromethoxy)phenyl]-2,4-dioxobutanoate (PubChem CID 17024669) has the molecular formula C12H10F2O5 and a molecular weight of 272.20 g/mol. Its IUPAC name is methyl 4-[4-(difluoromethoxy)phenyl]-2,4-dioxobutanoate.
| Compound Name | methyl 4-[4-(difluoromethoxy)phenyl]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 17024669 |
| Molecular Formula | C12H10F2O5 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | methyl 4-[4-(difluoromethoxy)phenyl]-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C12H10F2O5/c1-18-11(17)10(16)6-9(15)7-2-4-8(5-3-7)19-12(13)14/h2-5,12H,6H2,1H3 |
| InChIKey | IQSRGGMRZAEQNE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|