C16H18F2O4 — CID 58304059
methyl 1-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]cyclopentane-1-carboxylate (PubChem CID 58304059) has the molecular formula C16H18F2O4 and a molecular weight of 312.31 g/mol. Its IUPAC name is methyl 1-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 58304059 |
| Molecular Formula | C16H18F2O4 |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 1-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(CC(=O)c2ccc(OC(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C16H18F2O4/c1-21-14(20)16(8-2-3-9-16)10-13(19)11-4-6-12(7-5-11)22-15(17)18/h4-7,15H,2-3,8-10H2,1H3 |
| InChIKey | JQQNJACBVRBCHB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |