C14H17F2NO3 — CID 62518563
4-(difluoromethoxy)-N-[1-(hydroxymethyl)cyclopentyl]benzamide (PubChem CID 62518563) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[1-(hydroxymethyl)cyclopentyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-N-[1-(hydroxymethyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 62518563 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-(difluoromethoxy)-N-[1-(hydroxymethyl)cyclopentyl]benzamide |
| SMILES | O=C(NC1(CO)CCCC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H17F2NO3/c15-13(16)20-11-5-3-10(4-6-11)12(19)17-14(9-18)7-1-2-8-14/h3-6,13,18H,1-2,7-9H2,(H,17,19) |
| InChIKey | RRLONTQGFLSODV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |