C15H17F4NO4S — CID 154864603
3,5-bis(difluoromethoxy)-N-[4-(hydroxymethyl)thian-4-yl]benzamide (PubChem CID 154864603) has the molecular formula C15H17F4NO4S and a molecular weight of 383.36 g/mol. Its IUPAC name is 3,5-bis(difluoromethoxy)-N-[4-(hydroxymethyl)thian-4-yl]benzamide.
| Compound Name | 3,5-bis(difluoromethoxy)-N-[4-(hydroxymethyl)thian-4-yl]benzamide |
|---|---|
| PubChem CID | 154864603 |
| Molecular Formula | C15H17F4NO4S |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 3,5-bis(difluoromethoxy)-N-[4-(hydroxymethyl)thian-4-yl]benzamide |
| SMILES | O=C(NC1(CO)CCSCC1)c1cc(OC(F)F)cc(OC(F)F)c1 |
| InChI | InChI=1S/C15H17F4NO4S/c16-13(17)23-10-5-9(6-11(7-10)24-14(18)19)12(22)20-15(8-21)1-3-25-4-2-15/h5-7,13-14,21H,1-4,8H2,(H,20,22) |
| InChIKey | NZFVBDRBIYHIPB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |