C20H29NO3S — CID 167821623
4-(cyclohexylmethoxy)-N-[4-(hydroxymethyl)thian-4-yl]benzamide (PubChem CID 167821623) has the molecular formula C20H29NO3S and a molecular weight of 363.52 g/mol. Its IUPAC name is 4-(cyclohexylmethoxy)-N-[4-(hydroxymethyl)thian-4-yl]benzamide.
| Compound Name | 4-(cyclohexylmethoxy)-N-[4-(hydroxymethyl)thian-4-yl]benzamide |
|---|---|
| PubChem CID | 167821623 |
| Molecular Formula | C20H29NO3S |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 4-(cyclohexylmethoxy)-N-[4-(hydroxymethyl)thian-4-yl]benzamide |
| SMILES | O=C(NC1(CO)CCSCC1)c1ccc(OCC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H29NO3S/c22-15-20(10-12-25-13-11-20)21-19(23)17-6-8-18(9-7-17)24-14-16-4-2-1-3-5-16/h6-9,16,22H,1-5,10-15H2,(H,21,23) |
| InChIKey | LYUHBGRTFHFODS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |