C21H26NO6P — CID 10812007
[4-[[4-(cyclohexylmethoxy)phenyl]methylcarbamoyl]phenyl] dihydrogen phosphate (PubChem CID 10812007) has the molecular formula C21H26NO6P and a molecular weight of 419.41 g/mol. Its IUPAC name is [4-[[4-(cyclohexylmethoxy)phenyl]methylcarbamoyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[[4-(cyclohexylmethoxy)phenyl]methylcarbamoyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10812007 |
| Molecular Formula | C21H26NO6P |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [4-[[4-(cyclohexylmethoxy)phenyl]methylcarbamoyl]phenyl] dihydrogen phosphate |
| SMILES | O=C(NCc1ccc(OCC2CCCCC2)cc1)c1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C21H26NO6P/c23-21(18-8-12-20(13-9-18)28-29(24,25)26)22-14-16-6-10-19(11-7-16)27-15-17-4-2-1-3-5-17/h6-13,17H,1-5,14-15H2,(H,22,23)(H2,24,25,26) |
| InChIKey | VKIWORIFFBZFHJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|