C22H25NO4 — CID 1192156
cyclohexyl 2-[4-(benzylcarbamoyl)phenoxy]acetate (PubChem CID 1192156) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is cyclohexyl 2-[4-(benzylcarbamoyl)phenoxy]acetate.
| Compound Name | cyclohexyl 2-[4-(benzylcarbamoyl)phenoxy]acetate |
|---|---|
| PubChem CID | 1192156 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | cyclohexyl 2-[4-(benzylcarbamoyl)phenoxy]acetate |
| SMILES | O=C(COc1ccc(C(=O)NCc2ccccc2)cc1)OC1CCCCC1 |
| InChI | InChI=1S/C22H25NO4/c24-21(27-20-9-5-2-6-10-20)16-26-19-13-11-18(12-14-19)22(25)23-15-17-7-3-1-4-8-17/h1,3-4,7-8,11-14,20H,2,5-6,9-10,15-16H2,(H,23,25) |
| InChIKey | GUJJPBSIXLBEQW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |