C22H23FN2O6 — CID 22093477
cyclohexyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate (PubChem CID 22093477) has the molecular formula C22H23FN2O6 and a molecular weight of 430.43 g/mol. Its IUPAC name is cyclohexyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate.
| Compound Name | cyclohexyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 22093477 |
| Molecular Formula | C22H23FN2O6 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | cyclohexyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate |
| SMILES | O=C(COc1cc(F)ccc1C(=O)NCc1cccc([N+](=O)[O-])c1)OC1CCCCC1 |
| InChI | InChI=1S/C22H23FN2O6/c23-16-9-10-19(22(27)24-13-15-5-4-6-17(11-15)25(28)29)20(12-16)30-14-21(26)31-18-7-2-1-3-8-18/h4-6,9-12,18H,1-3,7-8,13-14H2,(H,24,27) |
| InChIKey | OOGBZQRLWLKREU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|