C14H16N2O7 — CID 23889686
cyclohexyl 2-(2,4-dinitrophenoxy)acetate (PubChem CID 23889686) has the molecular formula C14H16N2O7 and a molecular weight of 324.29 g/mol. Its IUPAC name is cyclohexyl 2-(2,4-dinitrophenoxy)acetate.
| Compound Name | cyclohexyl 2-(2,4-dinitrophenoxy)acetate |
|---|---|
| PubChem CID | 23889686 |
| Molecular Formula | C14H16N2O7 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | cyclohexyl 2-(2,4-dinitrophenoxy)acetate |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])OC1CCCCC1 |
| InChI | InChI=1S/C14H16N2O7/c17-14(23-11-4-2-1-3-5-11)9-22-13-7-6-10(15(18)19)8-12(13)16(20)21/h6-8,11H,1-5,9H2 |
| InChIKey | MPACLIJSJIYDEY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|