C12H12ClNO7S — CID 8956816
[(3R)-1,1-dioxothiolan-3-yl] 2-(2-chloro-4-nitrophenoxy)acetate (PubChem CID 8956816) has the molecular formula C12H12ClNO7S and a molecular weight of 349.75 g/mol. Its IUPAC name is [(3R)-1,1-dioxothiolan-3-yl] 2-(2-chloro-4-nitrophenoxy)acetate.
| Compound Name | [(3R)-1,1-dioxothiolan-3-yl] 2-(2-chloro-4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 8956816 |
| Molecular Formula | C12H12ClNO7S |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | [(3R)-1,1-dioxothiolan-3-yl] 2-(2-chloro-4-nitrophenoxy)acetate |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Cl)O[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12ClNO7S/c13-10-5-8(14(16)17)1-2-11(10)20-6-12(15)21-9-3-4-22(18,19)7-9/h1-2,5,9H,3-4,6-7H2/t9-/m1/s1 |
| InChIKey | IPNGEUPJUBANKR-SECBINFHSA-N |
| XLogP | 1.36 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|