C12H13BrO5S — CID 2330703
[(3S)-1,1-dioxothiolan-3-yl] 2-(4-bromophenoxy)acetate (PubChem CID 2330703) has the molecular formula C12H13BrO5S and a molecular weight of 349.20 g/mol. Its IUPAC name is [(3S)-1,1-dioxothiolan-3-yl] 2-(4-bromophenoxy)acetate.
| Compound Name | [(3S)-1,1-dioxothiolan-3-yl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 2330703 |
| Molecular Formula | C12H13BrO5S |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | [(3S)-1,1-dioxothiolan-3-yl] 2-(4-bromophenoxy)acetate |
| SMILES | O=C(COc1ccc(Br)cc1)O[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13BrO5S/c13-9-1-3-10(4-2-9)17-7-12(14)18-11-5-6-19(15,16)8-11/h1-4,11H,5-8H2/t11-/m0/s1 |
| InChIKey | ZNRIOANQHTVOPZ-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |