About [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate
[2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate (PubChem CID 166570820) has the molecular formula C11H18O6S
and a molecular weight of 278.33 g/mol. Its IUPAC name is [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate.
Analyze [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate?
The IUPAC name of [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate (CID 166570820) is [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate.
What is the SMILES notation for [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate?
The canonical SMILES for [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate is CCC(C)C(=O)OCC(=O)OC1CCS(=O)(=O)C1.
What is the InChIKey of [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate?
The InChIKey is MOBZBLIZHLKYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6S/c1-3-8(2)11(13)16-6-10(12)17-9-4-5-18(14,15)7-9/h8-9H,3-7H2,1-2H3.
What are the key properties of [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate?
[2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate has a molecular weight of 278.33 g/mol, XLogP of 0.31, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,1-dioxothiolan-3-yl)oxy-2-oxoethyl] 2-methylbutanoate is sourced from PubChem (CID 166570820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).