C6H12N2O6S2 — CID 167046402
(1,1-dioxothiolan-3-yl) N-amino-N-methylsulfonylcarbamate (PubChem CID 167046402) has the molecular formula C6H12N2O6S2 and a molecular weight of 272.30 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) N-amino-N-methylsulfonylcarbamate.
| Compound Name | (1,1-dioxothiolan-3-yl) N-amino-N-methylsulfonylcarbamate |
|---|---|
| PubChem CID | 167046402 |
| Molecular Formula | C6H12N2O6S2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) N-amino-N-methylsulfonylcarbamate |
| SMILES | CS(=O)(=O)N(N)C(=O)OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H12N2O6S2/c1-15(10,11)8(7)6(9)14-5-2-3-16(12,13)4-5/h5H,2-4,7H2,1H3 |
| InChIKey | YMXLXLZMHWDVPB-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|