C7H15N2O7PS — CID 167046451
(1,1-dioxothiolan-3-yl) N-amino-N-dimethoxyphosphorylcarbamate (PubChem CID 167046451) has the molecular formula C7H15N2O7PS and a molecular weight of 302.25 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) N-amino-N-dimethoxyphosphorylcarbamate.
| Compound Name | (1,1-dioxothiolan-3-yl) N-amino-N-dimethoxyphosphorylcarbamate |
|---|---|
| PubChem CID | 167046451 |
| Molecular Formula | C7H15N2O7PS |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) N-amino-N-dimethoxyphosphorylcarbamate |
| SMILES | COP(=O)(OC)N(N)C(=O)OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H15N2O7PS/c1-14-17(11,15-2)9(8)7(10)16-6-3-4-18(12,13)5-6/h6H,3-5,8H2,1-2H3 |
| InChIKey | ODNVNMJDSCITJJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|