C13H18O4S2 — CID 86779390
(1,1-dioxothiolan-3-yl) 5-tert-butylthiophene-2-carboxylate (PubChem CID 86779390) has the molecular formula C13H18O4S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) 5-tert-butylthiophene-2-carboxylate.
| Compound Name | (1,1-dioxothiolan-3-yl) 5-tert-butylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 86779390 |
| Molecular Formula | C13H18O4S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) 5-tert-butylthiophene-2-carboxylate |
| SMILES | CC(C)(C)c1ccc(C(=O)OC2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C13H18O4S2/c1-13(2,3)11-5-4-10(18-11)12(14)17-9-6-7-19(15,16)8-9/h4-5,9H,6-8H2,1-3H3 |
| InChIKey | WMWOJPLNOSNPOI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |