About (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate
(1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate (PubChem CID 61320542) has the molecular formula C11H14N2O4S
and a molecular weight of 270.31 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate.
Analyze (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate?
The IUPAC name of (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate (CID 61320542) is (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate.
What is the SMILES notation for (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate?
The canonical SMILES for (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate is Cc1ncc(N)cc1C(=O)OC1CCS(=O)(=O)C1.
What is the InChIKey of (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate?
The InChIKey is QPHJRRUNTNOVIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4S/c1-7-10(4-8(12)5-13-7)11(14)17-9-2-3-18(15,16)6-9/h4-5,9H,2-3,6,12H2,1H3.
What are the key properties of (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate?
(1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate has a molecular weight of 270.31 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dioxothiolan-3-yl) 5-amino-2-methylpyridine-3-carboxylate is sourced from PubChem (CID 61320542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).