C12H15NO5S — CID 54914653
methyl 4-amino-3-(1,1-dioxothiolan-3-yl)oxybenzoate (PubChem CID 54914653) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is methyl 4-amino-3-(1,1-dioxothiolan-3-yl)oxybenzoate.
| Compound Name | methyl 4-amino-3-(1,1-dioxothiolan-3-yl)oxybenzoate |
|---|---|
| PubChem CID | 54914653 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | methyl 4-amino-3-(1,1-dioxothiolan-3-yl)oxybenzoate |
| SMILES | COC(=O)c1ccc(N)c(OC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H15NO5S/c1-17-12(14)8-2-3-10(13)11(6-8)18-9-4-5-19(15,16)7-9/h2-3,6,9H,4-5,7,13H2,1H3 |
| InChIKey | ALDVMRQKLXHDAI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|