C18H26N2O5 — CID 164529973
tert-butyl 4-(2-amino-5-methoxycarbonylphenoxy)piperidine-1-carboxylate (PubChem CID 164529973) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl 4-(2-amino-5-methoxycarbonylphenoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-amino-5-methoxycarbonylphenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164529973 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl 4-(2-amino-5-methoxycarbonylphenoxy)piperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(OC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C18H26N2O5/c1-18(2,3)25-17(22)20-9-7-13(8-10-20)24-15-11-12(16(21)23-4)5-6-14(15)19/h5-6,11,13H,7-10,19H2,1-4H3 |
| InChIKey | HRTBAWUKLFRPKI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|