C18H25NO6 — CID 68532897
tert-butyl 4-(5-hydroxy-2-methoxycarbonylphenoxy)piperidine-1-carboxylate (PubChem CID 68532897) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is tert-butyl 4-(5-hydroxy-2-methoxycarbonylphenoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-hydroxy-2-methoxycarbonylphenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68532897 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | tert-butyl 4-(5-hydroxy-2-methoxycarbonylphenoxy)piperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(O)cc1OC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H25NO6/c1-18(2,3)25-17(22)19-9-7-13(8-10-19)24-15-11-12(20)5-6-14(15)16(21)23-4/h5-6,11,13,20H,7-10H2,1-4H3 |
| InChIKey | ZFVCXOJKOKXCAA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |