C20H29NO7S — CID 68984474
tert-butyl 4-(5-ethylsulfonyl-2-methoxycarbonylphenoxy)piperidine-1-carboxylate (PubChem CID 68984474) has the molecular formula C20H29NO7S and a molecular weight of 427.52 g/mol. Its IUPAC name is tert-butyl 4-(5-ethylsulfonyl-2-methoxycarbonylphenoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-ethylsulfonyl-2-methoxycarbonylphenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68984474 |
| Molecular Formula | C20H29NO7S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | tert-butyl 4-(5-ethylsulfonyl-2-methoxycarbonylphenoxy)piperidine-1-carboxylate |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)OC)c(OC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H29NO7S/c1-6-29(24,25)15-7-8-16(18(22)26-5)17(13-15)27-14-9-11-21(12-10-14)19(23)28-20(2,3)4/h7-8,13-14H,6,9-12H2,1-5H3 |
| InChIKey | WGKMWQZKFSMKIL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |