C18H25NO4S — CID 91353543
tert-butyl (3S)-3-(2-methoxycarbothioyl-5-methylphenoxy)pyrrolidine-1-carboxylate (PubChem CID 91353543) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is tert-butyl (3S)-3-(2-methoxycarbothioyl-5-methylphenoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(2-methoxycarbothioyl-5-methylphenoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91353543 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | tert-butyl (3S)-3-(2-methoxycarbothioyl-5-methylphenoxy)pyrrolidine-1-carboxylate |
| SMILES | COC(=S)c1ccc(C)cc1O[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H25NO4S/c1-12-6-7-14(16(24)21-5)15(10-12)22-13-8-9-19(11-13)17(20)23-18(2,3)4/h6-7,10,13H,8-9,11H2,1-5H3/t13-/m0/s1 |
| InChIKey | AFYBEISMKZEAPL-ZDUSSCGKSA-N |
| XLogP | 3.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|