C17H22BrNO5 — CID 122634557
tert-butyl (3S)-3-(2-bromo-4-methoxycarbonylphenoxy)pyrrolidine-1-carboxylate (PubChem CID 122634557) has the molecular formula C17H22BrNO5 and a molecular weight of 400.27 g/mol. Its IUPAC name is tert-butyl (3S)-3-(2-bromo-4-methoxycarbonylphenoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(2-bromo-4-methoxycarbonylphenoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 122634557 |
| Molecular Formula | C17H22BrNO5 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | tert-butyl (3S)-3-(2-bromo-4-methoxycarbonylphenoxy)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(O[C@H]2CCN(C(=O)OC(C)(C)C)C2)c(Br)c1 |
| InChI | InChI=1S/C17H22BrNO5/c1-17(2,3)24-16(21)19-8-7-12(10-19)23-14-6-5-11(9-13(14)18)15(20)22-4/h5-6,9,12H,7-8,10H2,1-4H3/t12-/m0/s1 |
| InChIKey | HLEWANUGBSTUBP-LBPRGKRZSA-N |
| XLogP | 3.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |