C23H27BrN2O4 — CID 122634579
tert-butyl 3-[2-bromo-4-(phenacylamino)phenoxy]pyrrolidine-1-carboxylate (PubChem CID 122634579) has the molecular formula C23H27BrN2O4 and a molecular weight of 475.38 g/mol. Its IUPAC name is tert-butyl 3-[2-bromo-4-(phenacylamino)phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-bromo-4-(phenacylamino)phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 122634579 |
| Molecular Formula | C23H27BrN2O4 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | tert-butyl 3-[2-bromo-4-(phenacylamino)phenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(NCC(=O)c3ccccc3)cc2Br)C1 |
| InChI | InChI=1S/C23H27BrN2O4/c1-23(2,3)30-22(28)26-12-11-18(15-26)29-21-10-9-17(13-19(21)24)25-14-20(27)16-7-5-4-6-8-16/h4-10,13,18,25H,11-12,14-15H2,1-3H3 |
| InChIKey | BZIXTCUSXVWRNU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|