C18H26N2O6S — CID 53256088
tert-butyl 4-[(4-methoxycarbonylphenyl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 53256088) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is tert-butyl 4-[(4-methoxycarbonylphenyl)sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-methoxycarbonylphenyl)sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 53256088 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | tert-butyl 4-[(4-methoxycarbonylphenyl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H26N2O6S/c1-18(2,3)26-17(22)20-11-9-14(10-12-20)19-27(23,24)15-7-5-13(6-8-15)16(21)25-4/h5-8,14,19H,9-12H2,1-4H3 |
| InChIKey | HLSJNCXRRJEOQJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |