C24H27N3O6S — CID 168518895
tert-butyl 4-[[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 168518895) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is tert-butyl 4-[[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168518895 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | tert-butyl 4-[[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NS(=O)(=O)c2ccc(N3C(=O)c4ccccc4C3=O)cc2)CC1 |
| InChI | InChI=1S/C24H27N3O6S/c1-24(2,3)33-23(30)26-14-12-16(13-15-26)25-34(31,32)18-10-8-17(9-11-18)27-21(28)19-6-4-5-7-20(19)22(27)29/h4-11,16,25H,12-15H2,1-3H3 |
| InChIKey | IBCUPTZQZSSGJJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|